Organometallic Compounds
Filtered Search Results
LiChropur™ 1-(Trimethylsilyl)imidazole, ≥94.0%, MilliporeSigma™ Supelco™
MDL Number: MFCD00005280 Synonym: TSIM; N-Trimethylsilylimidazole; TMSI; TSIM
| MDL Number | MFCD00005280 |
|---|---|
| Synonym | TSIM; N-Trimethylsilylimidazole; TMSI; TSIM |
Zincon monosodium salt, For Spectrophotometric Det. of Cu and Zn, MilliporeSigma™ Supelco™
MDL Number: MFCD00064385 Synonym: 2-Carboxy-2 ′-hydroxy-5 ′-sulfoformazyl-benzene monosodium salt; 2-[5-(2-Hydroxy-5-sulfophenyl)-3-phenyl-1-formazyl]benzoic acid monosodium salt
| MDL Number | MFCD00064385 |
|---|---|
| Synonym | 2-Carboxy-2 ′-hydroxy-5 ′-sulfoformazyl-benzene monosodium salt; 2-[5-(2-Hydroxy-5-sulfophenyl)-3-phenyl-1-formazyl]benzoic acid monosodium salt |
tert-Butyldimethylsilyl chloride, 50 wt.% solution in toluene, AcroSeal™
CAS: 18162-48-6 | C6H15ClSi | 150.72 g/mol
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.72 |
| ChEBI | CHEBI:85071 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
(Ethylthio)trimethylsilane, 90%, Thermo Scientific Chemicals
CAS: 5573-62-6 Molecular Formula: C5H14SSi Molecular Weight (g/mol): 134.31 MDL Number: MFCD00042890 InChI Key: HXAFQWICVBBXMZ-UHFFFAOYSA-N Synonym: ethylthio trimethylsilane,ethylthiotrimethylsilane,ethylthio trimethylsilane, technical grade,acmc-20aplk,trimethyl ethylthio silane,ethyl thio trimethylsilane,ethyl trimethylsilyl sulfide,trimethylsilyl ethyl sulfide,ethylsulfanyl trimethylsilane,ethylsulfanyl trimethyl silane PubChem CID: 2733426 IUPAC Name: ethylsulfanyl(trimethyl)silane SMILES: CCS[Si](C)(C)C
| PubChem CID | 2733426 |
|---|---|
| CAS | 5573-62-6 |
| Molecular Weight (g/mol) | 134.31 |
| MDL Number | MFCD00042890 |
| SMILES | CCS[Si](C)(C)C |
| Synonym | ethylthio trimethylsilane,ethylthiotrimethylsilane,ethylthio trimethylsilane, technical grade,acmc-20aplk,trimethyl ethylthio silane,ethyl thio trimethylsilane,ethyl trimethylsilyl sulfide,trimethylsilyl ethyl sulfide,ethylsulfanyl trimethylsilane,ethylsulfanyl trimethyl silane |
| IUPAC Name | ethylsulfanyl(trimethyl)silane |
| InChI Key | HXAFQWICVBBXMZ-UHFFFAOYSA-N |
| Molecular Formula | C5H14SSi |
Sodium bis(trimethylsilyl)amide, 98%
CAS: 1070-89-9 Molecular Formula: C6H18NNaSi2 Molecular Weight (g/mol): 183.377 MDL Number: MFCD00009835 InChI Key: WRIKHQLVHPKCJU-UHFFFAOYSA-N Synonym: sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt PubChem CID: 2724254 IUPAC Name: sodium;bis(trimethylsilyl)azanide SMILES: C[Si](C)(C)[N-][Si](C)(C)C.[Na+]
| PubChem CID | 2724254 |
|---|---|
| CAS | 1070-89-9 |
| Molecular Weight (g/mol) | 183.377 |
| MDL Number | MFCD00009835 |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Synonym | sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |
| IUPAC Name | sodium;bis(trimethylsilyl)azanide |
| InChI Key | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| Molecular Formula | C6H18NNaSi2 |
Diethylgermanium dichloride
CAS: 13314-52-8 Molecular Formula: C4H14Cl2Ge Molecular Weight (g/mol): 205.69 MDL Number: MFCD00013589 InChI Key: FVUWAWRMMUJVGO-UHFFFAOYSA-N Synonym: diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane PubChem CID: 83334 IUPAC Name: dichloro(diethyl)germane SMILES: Cl.Cl.CC[GeH2]CC
| PubChem CID | 83334 |
|---|---|
| CAS | 13314-52-8 |
| Molecular Weight (g/mol) | 205.69 |
| MDL Number | MFCD00013589 |
| SMILES | Cl.Cl.CC[GeH2]CC |
| Synonym | diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane |
| IUPAC Name | dichloro(diethyl)germane |
| InChI Key | FVUWAWRMMUJVGO-UHFFFAOYSA-N |
| Molecular Formula | C4H14Cl2Ge |
Bismuth 2-ethylhexanoate
CAS: 67874-71-9 Molecular Formula: C24H48BiO6 Molecular Weight (g/mol): 641.622 MDL Number: MFCD00043803 InChI Key: MWXWNYHYPMRCHN-UHFFFAOYSA-N Synonym: 2-Ethylhexanoic acid bismuth salt PubChem CID: 131857451 IUPAC Name: bismuth;2-ethylhexanoic acid SMILES: CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.[Bi]
| PubChem CID | 131857451 |
|---|---|
| CAS | 67874-71-9 |
| Molecular Weight (g/mol) | 641.622 |
| MDL Number | MFCD00043803 |
| SMILES | CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.[Bi] |
| Synonym | 2-Ethylhexanoic acid bismuth salt |
| IUPAC Name | bismuth;2-ethylhexanoic acid |
| InChI Key | MWXWNYHYPMRCHN-UHFFFAOYSA-N |
| Molecular Formula | C24H48BiO6 |
Diphenyl selenide, 97%
CAS: 1132-39-4 Molecular Formula: C12H10Se Molecular Weight (g/mol): 233.183 MDL Number: MFCD00014067 InChI Key: ORQWTLCYLDRDHK-UHFFFAOYSA-N Synonym: diphenyl selenide,diphenylselenium,phenyl selenide,biphenyl selenide,selenide, phenyl,benzene, 1,1'-selenobis,biphenyl selenium,difenylselenium,1,1'-selenobisbenzene,diphenyl selenium PubChem CID: 14333 IUPAC Name: phenylselanylbenzene SMILES: C1=CC=C(C=C1)[Se]C2=CC=CC=C2
| PubChem CID | 14333 |
|---|---|
| CAS | 1132-39-4 |
| Molecular Weight (g/mol) | 233.183 |
| MDL Number | MFCD00014067 |
| SMILES | C1=CC=C(C=C1)[Se]C2=CC=CC=C2 |
| Synonym | diphenyl selenide,diphenylselenium,phenyl selenide,biphenyl selenide,selenide, phenyl,benzene, 1,1'-selenobis,biphenyl selenium,difenylselenium,1,1'-selenobisbenzene,diphenyl selenium |
| IUPAC Name | phenylselanylbenzene |
| InChI Key | ORQWTLCYLDRDHK-UHFFFAOYSA-N |
| Molecular Formula | C12H10Se |
Methylgermanium trichloride, 97%
CAS: 993-10-2 Molecular Formula: CH9Cl3Ge Molecular Weight (g/mol): 200.06 MDL Number: MFCD00013585 InChI Key: NNMJXXWNUALEKD-UHFFFAOYSA-N Synonym: methyltrichlorogermane,trichloro methyl germane,methylgermanium trichloride,germanium methyl trichloride,germane, trichloromethyl,fefxfmqvsdtspa-uhfffaoysa,inchi=1/ch3cl3ge/c1-5 2,3 4/h1h3 PubChem CID: 70436 IUPAC Name: trichloro(methyl)germane SMILES: Cl.Cl.Cl.C[GeH3]
| PubChem CID | 70436 |
|---|---|
| CAS | 993-10-2 |
| Molecular Weight (g/mol) | 200.06 |
| MDL Number | MFCD00013585 |
| SMILES | Cl.Cl.Cl.C[GeH3] |
| Synonym | methyltrichlorogermane,trichloro methyl germane,methylgermanium trichloride,germanium methyl trichloride,germane, trichloromethyl,fefxfmqvsdtspa-uhfffaoysa,inchi=1/ch3cl3ge/c1-5 2,3 4/h1h3 |
| IUPAC Name | trichloro(methyl)germane |
| InChI Key | NNMJXXWNUALEKD-UHFFFAOYSA-N |
| Molecular Formula | CH9Cl3Ge |
Tris[N,N-bis(trimethylsilyl)amide]lanthanum(III), 97%
CAS: 35788-99-9 Molecular Formula: C18H54LaN3Si6 Molecular Weight (g/mol): 620.066 MDL Number: MFCD00271009 InChI Key: ZDYNTRMQDURVDM-UHFFFAOYSA-N Synonym: lanthanum tris bis trimethylsilyl amide,tris bis trimethylsilyl amino lanthanum,bis trimethylsilyl azanide; lanthanum 3+,acmc-20ako2,lanthanum tris hexamethyldisilazide,lanthanum 3+ tris bis trimethylsilyl azanide,lanthanum tris trimethyl-n-trimethylsilyl silanaminide,lanthanum iii tris n,n-bis trimethylsiyl amide,silanamine,1,1,1-trimethyl-n-trimethylsilyl-, lanthanum 3+ salt 3:1 PubChem CID: 6093756 IUPAC Name: bis(trimethylsilyl)azanide;lanthanum(3+) SMILES: C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[La+3]
| PubChem CID | 6093756 |
|---|---|
| CAS | 35788-99-9 |
| Molecular Weight (g/mol) | 620.066 |
| MDL Number | MFCD00271009 |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[La+3] |
| Synonym | lanthanum tris bis trimethylsilyl amide,tris bis trimethylsilyl amino lanthanum,bis trimethylsilyl azanide; lanthanum 3+,acmc-20ako2,lanthanum tris hexamethyldisilazide,lanthanum 3+ tris bis trimethylsilyl azanide,lanthanum tris trimethyl-n-trimethylsilyl silanaminide,lanthanum iii tris n,n-bis trimethylsiyl amide,silanamine,1,1,1-trimethyl-n-trimethylsilyl-, lanthanum 3+ salt 3:1 |
| IUPAC Name | bis(trimethylsilyl)azanide;lanthanum(3+) |
| InChI Key | ZDYNTRMQDURVDM-UHFFFAOYSA-N |
| Molecular Formula | C18H54LaN3Si6 |
Phenethyltrichlorosilane, 95%, Thermo Scientific™
CAS: 940-41-0 Molecular Formula: C8H9Cl3Si Molecular Weight (g/mol): 239.60 MDL Number: MFCD00039290 InChI Key: FMYXZXAKZWIOHO-UHFFFAOYSA-N Synonym: phenethyltrichlorosilane,trichloro 2-phenylethyl silane,2-phenylethyl trichlorosilane,silane, trichlorophenethyl,trichlorophenethylsilane,trichloro phenethyl silane,silane, trichloro 2-phenylethyl,1-phenyl-2-trichlorosilyl ethane,unii-iar3080y7z,trichloro-2-phenylethylsilane PubChem CID: 70327 IUPAC Name: trichloro(2-phenylethyl)silane SMILES: Cl[Si](Cl)(Cl)CCC1=CC=CC=C1
| PubChem CID | 70327 |
|---|---|
| CAS | 940-41-0 |
| Molecular Weight (g/mol) | 239.60 |
| MDL Number | MFCD00039290 |
| SMILES | Cl[Si](Cl)(Cl)CCC1=CC=CC=C1 |
| Synonym | phenethyltrichlorosilane,trichloro 2-phenylethyl silane,2-phenylethyl trichlorosilane,silane, trichlorophenethyl,trichlorophenethylsilane,trichloro phenethyl silane,silane, trichloro 2-phenylethyl,1-phenyl-2-trichlorosilyl ethane,unii-iar3080y7z,trichloro-2-phenylethylsilane |
| IUPAC Name | trichloro(2-phenylethyl)silane |
| InChI Key | FMYXZXAKZWIOHO-UHFFFAOYSA-N |
| Molecular Formula | C8H9Cl3Si |
Phenyltriethoxysilane, 98%
CAS: 780-69-8 Molecular Formula: C12H20O3Si Molecular Weight (g/mol): 240.37 MDL Number: MFCD00009065 InChI Key: JCVQKRGIASEUKR-UHFFFAOYSA-N Synonym: phenyltriethoxysilane,triethoxy phenyl silane,silane, triethoxyphenyl,triethoxyfenylsilan,silane, phenyltriethoxy,benzeneorthosiliconic acid, triethyl ester,phenyl triethoxysilane,benzene, triethoxysilyl,triethoxyfenylsilan czech,unii-qi310t2x15 PubChem CID: 13075 IUPAC Name: triethoxy(phenyl)silane SMILES: CCO[Si](OCC)(OCC)C1=CC=CC=C1
| PubChem CID | 13075 |
|---|---|
| CAS | 780-69-8 |
| Molecular Weight (g/mol) | 240.37 |
| MDL Number | MFCD00009065 |
| SMILES | CCO[Si](OCC)(OCC)C1=CC=CC=C1 |
| Synonym | phenyltriethoxysilane,triethoxy phenyl silane,silane, triethoxyphenyl,triethoxyfenylsilan,silane, phenyltriethoxy,benzeneorthosiliconic acid, triethyl ester,phenyl triethoxysilane,benzene, triethoxysilyl,triethoxyfenylsilan czech,unii-qi310t2x15 |
| IUPAC Name | triethoxy(phenyl)silane |
| InChI Key | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| Molecular Formula | C12H20O3Si |
Dimethyl selenide
CAS: 593-79-3 Molecular Formula: C2H6Se Molecular Weight (g/mol): 109.041 MDL Number: MFCD00014848 InChI Key: RVIXKDRPFPUUOO-UHFFFAOYSA-N Synonym: dimethylselenide,dimethylselenium,dimethyl selenide,methyl selenide,methyl selenium,methane, selenobis,selenium dimethyl,selenide, dimethyl,ch3 2se,unii-yk0r6jkt6h PubChem CID: 11648 ChEBI: CHEBI:4610 IUPAC Name: methylselanylmethane SMILES: C[Se]C
| PubChem CID | 11648 |
|---|---|
| CAS | 593-79-3 |
| Molecular Weight (g/mol) | 109.041 |
| ChEBI | CHEBI:4610 |
| MDL Number | MFCD00014848 |
| SMILES | C[Se]C |
| Synonym | dimethylselenide,dimethylselenium,dimethyl selenide,methyl selenide,methyl selenium,methane, selenobis,selenium dimethyl,selenide, dimethyl,ch3 2se,unii-yk0r6jkt6h |
| IUPAC Name | methylselanylmethane |
| InChI Key | RVIXKDRPFPUUOO-UHFFFAOYSA-N |
| Molecular Formula | C2H6Se |
Di-n-butyltin oxide
CAS: 818-08-6 Molecular Formula: C8H18OSn Molecular Weight (g/mol): 248.941 MDL Number: MFCD00001992 InChI Key: JGFBRKRYDCGYKD-UHFFFAOYSA-N Synonym: dibutyltin oxide,stannane, dibutyloxo,dibutyl oxo tin,dibutyloxostannane,di-n-butyltin oxide,tin, dibutyloxo,dibutylstannane oxide,dibutyltinoxide,dibutyltin iv oxide,dibutyloxide of tin PubChem CID: 61221 IUPAC Name: dibutyl(oxo)tin SMILES: CCCC[Sn](=O)CCCC
| PubChem CID | 61221 |
|---|---|
| CAS | 818-08-6 |
| Molecular Weight (g/mol) | 248.941 |
| MDL Number | MFCD00001992 |
| SMILES | CCCC[Sn](=O)CCCC |
| Synonym | dibutyltin oxide,stannane, dibutyloxo,dibutyl oxo tin,dibutyloxostannane,di-n-butyltin oxide,tin, dibutyloxo,dibutylstannane oxide,dibutyltinoxide,dibutyltin iv oxide,dibutyloxide of tin |
| IUPAC Name | dibutyl(oxo)tin |
| InChI Key | JGFBRKRYDCGYKD-UHFFFAOYSA-N |
| Molecular Formula | C8H18OSn |
1-(tert-Butyldimethylsilyl)imidazole, 97%
CAS: 54925-64-3 Molecular Formula: C9H18N2Si Molecular Weight (g/mol): 182.34 MDL Number: MFCD00011682 InChI Key: VUENSYJCBOSTCS-UHFFFAOYSA-N Synonym: 1-tert-butyldimethylsilyl-1h-imidazole,1-tert-butyldimethylsilyl imidazole,tert-butyldimethylsilylimidazole,n-tert-butyldimethylsilylimidazole,t-butyldimethylsilylimidazole,1-t-butyldimethylsilyl imidazole,1h-imidazole, 1-1,1-dimethylethyl dimethylsilyl,tbdmsim,imidazole, tbdms derivative,1-tert-butyldimethylsilylimidazole PubChem CID: 171385 IUPAC Name: tert-butyl-imidazol-1-yl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)N1C=CN=C1
| PubChem CID | 171385 |
|---|---|
| CAS | 54925-64-3 |
| Molecular Weight (g/mol) | 182.34 |
| MDL Number | MFCD00011682 |
| SMILES | CC(C)(C)[Si](C)(C)N1C=CN=C1 |
| Synonym | 1-tert-butyldimethylsilyl-1h-imidazole,1-tert-butyldimethylsilyl imidazole,tert-butyldimethylsilylimidazole,n-tert-butyldimethylsilylimidazole,t-butyldimethylsilylimidazole,1-t-butyldimethylsilyl imidazole,1h-imidazole, 1-1,1-dimethylethyl dimethylsilyl,tbdmsim,imidazole, tbdms derivative,1-tert-butyldimethylsilylimidazole |
| IUPAC Name | tert-butyl-imidazol-1-yl-dimethylsilane |
| InChI Key | VUENSYJCBOSTCS-UHFFFAOYSA-N |
| Molecular Formula | C9H18N2Si |